C21H20ClF3N2O3S — CID 59122627
[13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl] trifluoromethanesulfonate (PubChem CID 59122627) has the molecular formula C21H20ClF3N2O3S and a molecular weight of 472.92 g/mol. Its IUPAC name is [13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl] trifluoromethanesulfonate.
| Compound Name | [13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59122627 |
| Molecular Formula | C21H20ClF3N2O3S |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [13-chloro-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl] trifluoromethanesulfonate |
| SMILES | CN1CCC(C2c3ccc(Cl)cc3C=C(OS(=O)(=O)C(F)(F)F)c3cccnc32)CC1 |
| InChI | InChI=1S/C21H20ClF3N2O3S/c1-27-9-6-13(7-10-27)19-16-5-4-15(22)11-14(16)12-18(17-3-2-8-26-20(17)19)30-31(28,29)21(23,24)25/h2-5,8,11-13,19H,6-7,9-10H2,1H3 |
| InChIKey | LXOFSRIXHJLDKO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|