C28H37BClN4O+ — CID 59122634
[4-[13-chloro-9-[3-(4,5-dimethyl-1H-imidazol-3-ium-3-yl)propyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-methylborinic acid (PubChem CID 59122634) has the molecular formula C28H37BClN4O+ and a molecular weight of 491.90 g/mol. Its IUPAC name is [4-[13-chloro-9-[3-(4,5-dimethyl-1H-imidazol-3-ium-3-yl)propyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[13-chloro-9-[3-(4,5-dimethyl-1H-imidazol-3-ium-3-yl)propyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59122634 |
| Molecular Formula | C28H37BClN4O+ |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | [4-[13-chloro-9-[3-(4,5-dimethyl-1H-imidazol-3-ium-3-yl)propyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(C2c3ccc(Cl)cc3CC(CCC[n+]3c[nH]c(C)c3C)c3cccnc32)CC1 |
| InChI | InChI=1S/C28H36BClN4O/c1-19-20(2)33(18-32-19)13-5-6-22-16-23-17-24(30)8-9-25(23)27(28-26(22)7-4-12-31-28)21-10-14-34(15-11-21)29(3)35/h4,7-9,12,17-18,21-22,27,35H,5-6,10-11,13-16H2,1-3H3/p+1 |
| InChIKey | UKIPYAYZIFWEGG-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|