C22H18N2O4S — CID 59122795
methyl 4-[[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzoate (PubChem CID 59122795) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is methyl 4-[[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 59122795 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | methyl 4-[[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2c(C)c(/C=C3\SC(=O)NC3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H18N2O4S/c1-13-17(11-19-20(25)23-22(27)29-19)16-5-3-4-6-18(16)24(13)12-14-7-9-15(10-8-14)21(26)28-2/h3-11H,12H2,1-2H3,(H,23,25,27)/b19-11- |
| InChIKey | BDUPRIIUPYMGIK-ODLFYWEKSA-N |
| XLogP | 4.11 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|