About 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione
6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione (PubChem CID 591228) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione.
Molecular Properties
| Compound Name | 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione |
| PubChem CID | 591228 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione |
| SMILES | CC1=CC(=O)CC(C)C12CCC(=O)C2 |
| InChI | InChI=1S/C12H16O2/c1-8-5-11(14)6-9(2)12(8)4-3-10(13)7-12/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | OGDKSKNHHSXJNA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione?
The IUPAC name of 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione (CID 591228) is 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione.
What is the SMILES notation for 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione?
The canonical SMILES for 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione is CC1=CC(=O)CC(C)C12CCC(=O)C2.
What is the InChIKey of 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione?
The InChIKey is OGDKSKNHHSXJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-8-5-11(14)6-9(2)12(8)4-3-10(13)7-12/h5,9H,3-4,6-7H2,1-2H3.
What are the key properties of 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione?
6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione has a molecular weight of 192.26 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethylspiro[4.5]dec-9-ene-3,8-dione is sourced from PubChem (CID 591228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).