C31H30F6N8O2 — CID 59123003
4-[(4-cyclohexyl-N-[N'-(2,2,2-trifluoroethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 59123003) has the molecular formula C31H30F6N8O2 and a molecular weight of 660.62 g/mol. Its IUPAC name is 4-[(4-cyclohexyl-N-[N'-(2,2,2-trifluoroethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[(4-cyclohexyl-N-[N'-(2,2,2-trifluoroethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59123003 |
| Molecular Formula | C31H30F6N8O2 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 4-[(4-cyclohexyl-N-[N'-(2,2,2-trifluoroethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino)methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(Nc1nn[nH]n1)c1ccc(CN(/C(=N/CC(F)(F)F)Nc2ccc(OC(F)(F)F)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H30F6N8O2/c32-30(33,34)19-38-29(39-24-12-16-26(17-13-24)47-31(35,36)37)45(25-14-10-22(11-15-25)21-4-2-1-3-5-21)18-20-6-8-23(9-7-20)27(46)40-28-41-43-44-42-28/h6-17,21H,1-5,18-19H2,(H,38,39)(H2,40,41,42,43,44,46) |
| InChIKey | KULLOXAKXFPDFA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|