C31H28F3N9O2 — CID 59123096
4-[[N-[N'-(cyanomethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 59123096) has the molecular formula C31H28F3N9O2 and a molecular weight of 615.62 g/mol. Its IUPAC name is 4-[[N-[N'-(cyanomethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[N-[N'-(cyanomethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59123096 |
| Molecular Formula | C31H28F3N9O2 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | 4-[[N-[N'-(cyanomethyl)-N-[4-(trifluoromethoxy)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | N#CC/N=C(\Nc1ccc(OC(F)(F)F)cc1)N(Cc1ccc(C(=O)Nc2nn[nH]n2)cc1)c1ccc(C2=CCCCC2)cc1 |
| InChI | InChI=1S/C31H28F3N9O2/c32-31(33,34)45-27-16-12-25(13-17-27)37-30(36-19-18-35)43(26-14-10-23(11-15-26)22-4-2-1-3-5-22)20-21-6-8-24(9-7-21)28(44)38-29-39-41-42-40-29/h4,6-17H,1-3,5,19-20H2,(H,36,37)(H2,38,39,40,41,42,44) |
| InChIKey | UJQKPZRPNUVUAD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|