C27H34N4O3 — CID 59123451
1,5-diacetyl-7-[2-(dimethylamino)ethyl]-3-methyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one (PubChem CID 59123451) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1,5-diacetyl-7-[2-(dimethylamino)ethyl]-3-methyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | 1,5-diacetyl-7-[2-(dimethylamino)ethyl]-3-methyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 59123451 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1,5-diacetyl-7-[2-(dimethylamino)ethyl]-3-methyl-2,4-dipyridin-2-yl-3-azabicyclo[3.3.1]nonan-9-one |
| SMILES | CC(=O)C12CC(CCN(C)C)CC(C(C)=O)(C1=O)C(c1ccccn1)N(C)C2c1ccccn1 |
| InChI | InChI=1S/C27H34N4O3/c1-18(32)26-16-20(12-15-30(3)4)17-27(19(2)33,25(26)34)24(22-11-7-9-14-29-22)31(5)23(26)21-10-6-8-13-28-21/h6-11,13-14,20,23-24H,12,15-17H2,1-5H3 |
| InChIKey | PDNIZYZWBQQUED-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|