C5H4ClF5O — CID 59123625
4-chloro-3,4,5,5,5-pentafluoropentan-2-one (PubChem CID 59123625) has the molecular formula C5H4ClF5O and a molecular weight of 210.53 g/mol. Its IUPAC name is 4-chloro-3,4,5,5,5-pentafluoropentan-2-one.
| Compound Name | 4-chloro-3,4,5,5,5-pentafluoropentan-2-one |
|---|---|
| PubChem CID | 59123625 |
| Molecular Formula | C5H4ClF5O |
| Molecular Weight | 210.53 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 4-chloro-3,4,5,5,5-pentafluoropentan-2-one |
| SMILES | CC(=O)C(F)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C5H4ClF5O/c1-2(12)3(7)4(6,8)5(9,10)11/h3H,1H3 |
| InChIKey | GLPJOALTXVZQLM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|