C27H42Si — CID 59123722
bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-octylsilane (PubChem CID 59123722) has the molecular formula C27H42Si and a molecular weight of 394.72 g/mol. Its IUPAC name is bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-octylsilane.
| Compound Name | bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-octylsilane |
|---|---|
| PubChem CID | 59123722 |
| Molecular Formula | C27H42Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | bis(2,3,3a,7a-tetrahydro-1H-inden-1-yl)-methyl-octylsilane |
| SMILES | CCCCCCCC[Si](C)(C1CCC2C=CC=CC21)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C27H42Si/c1-3-4-5-6-7-12-21-28(2,26-19-17-22-13-8-10-15-24(22)26)27-20-18-23-14-9-11-16-25(23)27/h8-11,13-16,22-27H,3-7,12,17-21H2,1-2H3 |
| InChIKey | SQDFJJLGEXEEKS-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|