C22H19F2N3O4 — CID 59123890
methyl N-[6-(3,4-difluoroanilino)-5,8-dioxo-7-pyrrolidin-1-ylnaphthalen-2-yl]carbamate (PubChem CID 59123890) has the molecular formula C22H19F2N3O4 and a molecular weight of 427.41 g/mol. Its IUPAC name is methyl N-[6-(3,4-difluoroanilino)-5,8-dioxo-7-pyrrolidin-1-ylnaphthalen-2-yl]carbamate.
| Compound Name | methyl N-[6-(3,4-difluoroanilino)-5,8-dioxo-7-pyrrolidin-1-ylnaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 59123890 |
| Molecular Formula | C22H19F2N3O4 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | methyl N-[6-(3,4-difluoroanilino)-5,8-dioxo-7-pyrrolidin-1-ylnaphthalen-2-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)C(=O)C(N1CCCC1)=C(Nc1ccc(F)c(F)c1)C2=O |
| InChI | InChI=1S/C22H19F2N3O4/c1-31-22(30)26-12-4-6-14-15(10-12)21(29)19(27-8-2-3-9-27)18(20(14)28)25-13-5-7-16(23)17(24)11-13/h4-7,10-11,25H,2-3,8-9H2,1H3,(H,26,30) |
| InChIKey | LUOSLPVRRLLWFG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|