About (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid
(2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid (PubChem CID 59124125) has the molecular formula C10H16N2O6
and a molecular weight of 260.25 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid |
| PubChem CID | 59124125 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid |
| SMILES | CCC(=O)N[C@H]1C(=O)N([C@H](C)C(=O)O)OC[C@@H]1O |
| InChI | InChI=1S/C10H16N2O6/c1-3-7(14)11-8-6(13)4-18-12(9(8)15)5(2)10(16)17/h5-6,8,13H,3-4H2,1-2H3,(H,11,14)(H,16,17)/t5-,6+,8-/m1/s1 |
| InChIKey | YYISDUSOUMOFGK-GKROBHDKSA-N |
| XLogP | -1.51 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid?
The IUPAC name of (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid (CID 59124125) is (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid.
What is the SMILES notation for (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid?
The canonical SMILES for (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid is CCC(=O)N[C@H]1C(=O)N([C@H](C)C(=O)O)OC[C@@H]1O.
What is the InChIKey of (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid?
The InChIKey is YYISDUSOUMOFGK-GKROBHDKSA-N. The full InChI is InChI=1S/C10H16N2O6/c1-3-7(14)11-8-6(13)4-18-12(9(8)15)5(2)10(16)17/h5-6,8,13H,3-4H2,1-2H3,(H,11,14)(H,16,17)/t5-,6+,8-/m1/s1.
What are the key properties of (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid?
(2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid has a molecular weight of 260.25 g/mol, XLogP of -1.51, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4R,5R)-5-hydroxy-3-oxo-4-(propanoylamino)oxazinan-2-yl]propanoic acid is sourced from PubChem (CID 59124125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).