About (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium
(2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium (PubChem CID 59124459) has the molecular formula C5H6O3Y
and a molecular weight of 203.01 g/mol. Its IUPAC name is (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium.
Molecular Properties
| Compound Name | (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium |
| PubChem CID | 59124459 |
| Molecular Formula | C5H6O3Y |
| Molecular Weight | 203.01 g/mol |
| Exact Mass | 202.94 |
| IUPAC Name | (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium |
| SMILES | CC(=O)/C(C=O)=C\O.[Y] |
| InChI | InChI=1S/C5H6O3.Y/c1-4(8)5(2-6)3-7;/h2-3,6H,1H3;/b5-2-; |
| InChIKey | KEBSGZBOQHWJCO-PVOKDAACSA-N |
| XLogP | 0.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.01 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium?
The IUPAC name of (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium (CID 59124459) is (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium.
What is the SMILES notation for (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium?
The canonical SMILES for (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium is CC(=O)/C(C=O)=C\O.[Y].
What is the InChIKey of (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium?
The InChIKey is KEBSGZBOQHWJCO-PVOKDAACSA-N. The full InChI is InChI=1S/C5H6O3.Y/c1-4(8)5(2-6)3-7;/h2-3,6H,1H3;/b5-2-;.
What are the key properties of (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium?
(2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium has a molecular weight of 203.01 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(hydroxymethylidene)-3-oxobutanal;yttrium is sourced from PubChem (CID 59124459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).