C11H12O5 — CID 59124465
2-[(E)-but-2-enoyl]-4,5-dimethoxycyclopent-4-ene-1,3-dione (PubChem CID 59124465) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-[(E)-but-2-enoyl]-4,5-dimethoxycyclopent-4-ene-1,3-dione.
| Compound Name | 2-[(E)-but-2-enoyl]-4,5-dimethoxycyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 59124465 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-[(E)-but-2-enoyl]-4,5-dimethoxycyclopent-4-ene-1,3-dione |
| SMILES | C/C=C/C(=O)C1C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C11H12O5/c1-4-5-6(12)7-8(13)10(15-2)11(16-3)9(7)14/h4-5,7H,1-3H3/b5-4+ |
| InChIKey | CZKQAQAZWUTJMW-SNAWJCMRSA-N |
| XLogP | 0.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|