C26H34N2O4S — CID 59124645
6-(2,4-dimethylbenzoyl)-2-(3,5,5-trimethylhexanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 59124645) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is 6-(2,4-dimethylbenzoyl)-2-(3,5,5-trimethylhexanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 6-(2,4-dimethylbenzoyl)-2-(3,5,5-trimethylhexanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 59124645 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 6-(2,4-dimethylbenzoyl)-2-(3,5,5-trimethylhexanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N2CCc3c(sc(NC(=O)CC(C)CC(C)(C)C)c3C(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C26H34N2O4S/c1-15-7-8-18(17(3)11-15)24(30)28-10-9-19-20(14-28)33-23(22(19)25(31)32)27-21(29)12-16(2)13-26(4,5)6/h7-8,11,16H,9-10,12-14H2,1-6H3,(H,27,29)(H,31,32) |
| InChIKey | CZQRUTADMOMVTF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |