C12H13O2Y- — CID 59124825
1-[(2S)-2,3,4,6-tetrahydrochromen-6-id-2-yl]propan-2-one;yttrium (PubChem CID 59124825) has the molecular formula C12H13O2Y- and a molecular weight of 278.14 g/mol. Its IUPAC name is 1-[(2S)-2,3,4,6-tetrahydrochromen-6-id-2-yl]propan-2-one;yttrium.
| Compound Name | 1-[(2S)-2,3,4,6-tetrahydrochromen-6-id-2-yl]propan-2-one;yttrium |
|---|---|
| PubChem CID | 59124825 |
| Molecular Formula | C12H13O2Y- |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1-[(2S)-2,3,4,6-tetrahydrochromen-6-id-2-yl]propan-2-one;yttrium |
| SMILES | CC(=O)C[C@@H]1CCc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C12H13O2.Y/c1-9(13)8-11-7-6-10-4-2-3-5-12(10)14-11;/h3-5,11H,6-8H2,1H3;/q-1;/t11-;/m0./s1 |
| InChIKey | PWPSTJUCZOHRCT-MERQFXBCSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|