C18H20 — CID 59125009
1,4,4a,5,5a,6,11,12a-octahydrotetracene (PubChem CID 59125009) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,4,4a,5,5a,6,11,12a-octahydrotetracene.
| Compound Name | 1,4,4a,5,5a,6,11,12a-octahydrotetracene |
|---|---|
| PubChem CID | 59125009 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,4,4a,5,5a,6,11,12a-octahydrotetracene |
| SMILES | C1=CCC2CC3Cc4ccccc4CC3=CC2C1 |
| InChI | InChI=1S/C18H20/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-6,11,15-16,18H,7-10,12H2 |
| InChIKey | YPSQXAXTJGTGOI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|