C17H27F3N2O — CID 59125455
N-[(2E,4Z)-2-prop-1-en-2-yl-4-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dienyl]piperidin-3-amine (PubChem CID 59125455) has the molecular formula C17H27F3N2O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-[(2E,4Z)-2-prop-1-en-2-yl-4-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dienyl]piperidin-3-amine.
| Compound Name | N-[(2E,4Z)-2-prop-1-en-2-yl-4-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dienyl]piperidin-3-amine |
|---|---|
| PubChem CID | 59125455 |
| Molecular Formula | C17H27F3N2O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[(2E,4Z)-2-prop-1-en-2-yl-4-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dienyl]piperidin-3-amine |
| SMILES | C=C(C)/C(=C\C(=C\C)C(OC)C(F)(F)F)CNC1CCCNC1 |
| InChI | InChI=1S/C17H27F3N2O/c1-5-13(16(23-4)17(18,19)20)9-14(12(2)3)10-22-15-7-6-8-21-11-15/h5,9,15-16,21-22H,2,6-8,10-11H2,1,3-4H3/b13-5-,14-9- |
| InChIKey | IZMXCSBPQFULRW-NALVCRPMSA-N |
| XLogP | 3.35 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|