C18H24O2 — CID 59125859
methyl (5S,8E,10E,12R)-5,12-dimethylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 59125859) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is methyl (5S,8E,10E,12R)-5,12-dimethylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | methyl (5S,8E,10E,12R)-5,12-dimethylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 59125859 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | methyl (5S,8E,10E,12R)-5,12-dimethylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | C#CC[C@@H](C)/C=C/C=C/C#C[C@@H](C)CCCC(=O)OC |
| InChI | InChI=1S/C18H24O2/c1-5-11-16(2)12-8-6-7-9-13-17(3)14-10-15-18(19)20-4/h1,6-8,12,16-17H,10-11,14-15H2,2-4H3/b7-6+,12-8+/t16-,17-/m1/s1 |
| InChIKey | MMELYUQLTNTHAZ-OYIWNBKYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|