C44H66B2N14O32P6-8 — CID 59126072
CID 59126072 (PubChem CID 59126072) has the molecular formula C44H66B2N14O32P6-8 and a molecular weight of 1510.55 g/mol.
| Compound Name | CID 59126072 |
|---|---|
| PubChem CID | 59126072 |
| Molecular Formula | C44H66B2N14O32P6-8 |
| Molecular Weight | 1510.55 g/mol |
| Exact Mass | 1510.26 |
| IUPAC Name | — |
| SMILES | CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1OC(C)(n2cnc3c(N)ncnc32)C(O)C1OP(=O)([O-])[O-])C(O)C(=O)NCCC(=O)NCC[B][B]CCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC1OC(C)(n2cnc3c(N)ncnc32)C(O)C1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C44H74B2N14O32P6/c1-41(2,17-85-97(79,80)91-95(75,76)83-15-23-29(89-93(69,70)71)31(63)43(5,87-23)59-21-57-27-35(47)53-19-55-37(27)59)33(65)39(67)51-11-7-25(61)49-13-9-45-46-10-14-50-26(62)8-12-52-40(68)34(66)42(3,4)18-86-98(81,82)92-96(77,78)84-16-24-30(90-94(72,73)74)32(64)44(6,88-24)60-22-58-28-36(48)54-20-56-38(28)60/h19-24,29-34,63-66H,7-18H2,1-6H3,(H,49,61)(H,50,62)(H,51,67)(H,52,68)(H,75,76)(H,77,78)(H,79,80)(H,81,82)(H2,47,53,55)(H2,48,54,56)(H2,69,70,71)(H2,72,73,74)/p-8 |
| InChIKey | HVTDOXBVECSCLW-UHFFFAOYSA-F |
| XLogP | -8.72 |
| TPSA | 715.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 42 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 98 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1510.55 |
| LogP ≤ 5 | -8.72 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 42 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|