About CID 59126144
CID 59126144 (PubChem CID 59126144) has the molecular formula C39H51O2
and a molecular weight of 551.84 g/mol.
Molecular Properties
| Compound Name | CID 59126144 |
| PubChem CID | 59126144 |
| Molecular Formula | C39H51O2 |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.39 |
| IUPAC Name | — |
| SMILES | C/C=C(/C)c1ccc(C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)c2cc(C(C)(C)C)c([O])c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C39H51O2/c1-15-24(2)25-16-18-26(19-17-25)33(27-20-29(36(3,4)5)34(40)30(21-27)37(6,7)8)28-22-31(38(9,10)11)35(41)32(23-28)39(12,13)14/h15-23H,1-14H3/b24-15- |
| InChIKey | SQARNRVHGHTGGH-IWIPYMOSSA-N |
| XLogP | 11.18 |
| TPSA | 36.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59126144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59126144?
The IUPAC name of CID 59126144 (CID 59126144) is not available.
What is the SMILES notation for CID 59126144?
The canonical SMILES for CID 59126144 is C/C=C(/C)c1ccc(C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)c2cc(C(C)(C)C)c([O])c(C(C)(C)C)c2)cc1.
What is the InChIKey of CID 59126144?
The InChIKey is SQARNRVHGHTGGH-IWIPYMOSSA-N. The full InChI is InChI=1S/C39H51O2/c1-15-24(2)25-16-18-26(19-17-25)33(27-20-29(36(3,4)5)34(40)30(21-27)37(6,7)8)28-22-31(38(9,10)11)35(41)32(23-28)39(12,13)14/h15-23H,1-14H3/b24-15-.
What are the key properties of CID 59126144?
CID 59126144 has a molecular weight of 551.84 g/mol, XLogP of 11.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59126144 is sourced from PubChem (CID 59126144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).