C12H16F6O3 — CID 59126186
[1,1,1-trifluoro-2-hydroxy-5-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylprop-2-enoate (PubChem CID 59126186) has the molecular formula C12H16F6O3 and a molecular weight of 322.25 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-hydroxy-5-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1-trifluoro-2-hydroxy-5-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59126186 |
| Molecular Formula | C12H16F6O3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [1,1,1-trifluoro-2-hydroxy-5-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC(C)C)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6O3/c1-6(2)5-8(21-9(19)7(3)4)10(20,11(13,14)15)12(16,17)18/h6,8,20H,3,5H2,1-2,4H3 |
| InChIKey | WWHVRFBMTSQRCY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|