C18H21F3N6O4S2 — CID 59126404
ethyl 5-[[1-propyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126404) has the molecular formula C18H21F3N6O4S2 and a molecular weight of 506.53 g/mol. Its IUPAC name is ethyl 5-[[1-propyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-[[1-propyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126404 |
| Molecular Formula | C18H21F3N6O4S2 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | ethyl 5-[[1-propyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCN1CCCc2cc(/N=N/c3nnc(C(=O)OCC)s3)c(NS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H21F3N6O4S2/c1-3-7-27-8-5-6-11-9-12(13(10-14(11)27)26-33(29,30)18(19,20)21)22-24-17-25-23-15(32-17)16(28)31-4-2/h9-10,26H,3-8H2,1-2H3/b24-22+ |
| InChIKey | DZOVQTNIEJDSHM-ZNTNEXAZSA-N |
| XLogP | 4.55 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|