C23H31F3N6O4S2 — CID 59126455
butan-2-yl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126455) has the molecular formula C23H31F3N6O4S2 and a molecular weight of 576.67 g/mol. Its IUPAC name is butan-2-yl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | butan-2-yl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126455 |
| Molecular Formula | C23H31F3N6O4S2 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | butan-2-yl 5-[[2-methyl-1-pentyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCCN1c2cc(NS(=O)(=O)C(F)(F)F)c(/N=N/c3nnc(C(=O)OC(C)CC)s3)cc2CCC1C |
| InChI | InChI=1S/C23H31F3N6O4S2/c1-5-7-8-11-32-14(3)9-10-16-12-17(18(13-19(16)32)31-38(34,35)23(24,25)26)27-29-22-30-28-20(37-22)21(33)36-15(4)6-2/h12-15,31H,5-11H2,1-4H3/b29-27+ |
| InChIKey | AJGJHBLPDLQDTR-ORIPQNMZSA-N |
| XLogP | 6.50 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|