C21H22F8N6O4S2 — CID 59126478
1,1,2,2,2-pentafluoroethyl 5-[[2-ethyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126478) has the molecular formula C21H22F8N6O4S2 and a molecular weight of 638.56 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl 5-[[2-ethyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl 5-[[2-ethyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126478 |
| Molecular Formula | C21H22F8N6O4S2 |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl 5-[[2-ethyl-1-propan-2-yl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCC1CCc2cc(/N=N/c3nnc(C(=O)OC(F)(F)C(F)(F)F)s3)c(NS(=O)(=O)CC(F)(F)F)cc2N1C(C)C |
| InChI | InChI=1S/C21H22F8N6O4S2/c1-4-12-6-5-11-7-13(14(8-15(11)35(12)10(2)3)34-41(37,38)9-19(22,23)24)30-32-18-33-31-16(40-18)17(36)39-21(28,29)20(25,26)27/h7-8,10,12,34H,4-6,9H2,1-3H3/b32-30+ |
| InChIKey | YQXILMGKVWNABH-NHQGMKOOSA-N |
| XLogP | 6.51 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|