C17H14F8N6O4S2 — CID 59126527
1,1,2,2,2-pentafluoroethyl 5-[[1,2-dimethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126527) has the molecular formula C17H14F8N6O4S2 and a molecular weight of 582.46 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl 5-[[1,2-dimethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl 5-[[1,2-dimethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126527 |
| Molecular Formula | C17H14F8N6O4S2 |
| Molecular Weight | 582.46 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl 5-[[1,2-dimethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CC1CCc2cc(/N=N/c3nnc(C(=O)OC(F)(F)C(F)(F)F)s3)c(NS(=O)(=O)C(F)(F)F)cc2N1C |
| InChI | InChI=1S/C17H14F8N6O4S2/c1-7-3-4-8-5-9(10(6-11(8)31(7)2)30-37(33,34)17(23,24)25)26-28-14-29-27-12(36-14)13(32)35-16(21,22)15(18,19)20/h5-7,30H,3-4H2,1-2H3/b28-26+ |
| InChIKey | RHPSIGFCEHAYLT-BYCLXTJYSA-N |
| XLogP | 5.30 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|