C22H29F3N6O4S2 — CID 59126594
butyl 5-[[2-methyl-1-propyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126594) has the molecular formula C22H29F3N6O4S2 and a molecular weight of 562.64 g/mol. Its IUPAC name is butyl 5-[[2-methyl-1-propyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | butyl 5-[[2-methyl-1-propyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126594 |
| Molecular Formula | C22H29F3N6O4S2 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | butyl 5-[[2-methyl-1-propyl-7-(2,2,2-trifluoroethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCOC(=O)c1nnc(/N=N/c2cc3c(cc2NS(=O)(=O)CC(F)(F)F)N(CCC)C(C)CC3)s1 |
| InChI | InChI=1S/C22H29F3N6O4S2/c1-4-6-10-35-20(32)19-27-29-21(36-19)28-26-16-11-15-8-7-14(3)31(9-5-2)18(15)12-17(16)30-37(33,34)13-22(23,24)25/h11-12,14,30H,4-10,13H2,1-3H3/b28-26+ |
| InChIKey | XTBWIJIZZVEHRK-BYCLXTJYSA-N |
| XLogP | 5.77 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|