C22H27F3N6O4S2 — CID 59126773
cyclopentyl 5-[[1-butyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126773) has the molecular formula C22H27F3N6O4S2 and a molecular weight of 560.62 g/mol. Its IUPAC name is cyclopentyl 5-[[1-butyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | cyclopentyl 5-[[1-butyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126773 |
| Molecular Formula | C22H27F3N6O4S2 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | cyclopentyl 5-[[1-butyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCN1CCCc2cc(/N=N/c3nnc(C(=O)OC4CCCC4)s3)c(NS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C22H27F3N6O4S2/c1-2-3-10-31-11-6-7-14-12-16(17(13-18(14)31)30-37(33,34)22(23,24)25)26-28-21-29-27-19(36-21)20(32)35-15-8-4-5-9-15/h12-13,15,30H,2-11H2,1H3/b28-26+ |
| InChIKey | RYPBLAWQMIGKDS-BYCLXTJYSA-N |
| XLogP | 5.87 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|