C21H27F3N6O4S2 — CID 59126838
tert-butyl 5-[[1,2-diethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126838) has the molecular formula C21H27F3N6O4S2 and a molecular weight of 548.61 g/mol. Its IUPAC name is tert-butyl 5-[[1,2-diethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | tert-butyl 5-[[1,2-diethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126838 |
| Molecular Formula | C21H27F3N6O4S2 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | tert-butyl 5-[[1,2-diethyl-7-(trifluoromethylsulfonylamino)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCC1CCc2cc(/N=N/c3nnc(C(=O)OC(C)(C)C)s3)c(NS(=O)(=O)C(F)(F)F)cc2N1CC |
| InChI | InChI=1S/C21H27F3N6O4S2/c1-6-13-9-8-12-10-14(25-27-19-28-26-17(35-19)18(31)34-20(3,4)5)15(11-16(12)30(13)7-2)29-36(32,33)21(22,23)24/h10-11,13,29H,6-9H2,1-5H3/b27-25+ |
| InChIKey | YQSPDWWXIXTVPY-IMVLJIQESA-N |
| XLogP | 5.72 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|