C6H3F5N2O2S — CID 59126843
1,1,2,2,2-pentafluoroethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 59126843) has the molecular formula C6H3F5N2O2S and a molecular weight of 262.16 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 59126843 |
| Molecular Formula | C6H3F5N2O2S |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl 5-methyl-1,3,4-thiadiazole-2-carboxylate |
| SMILES | Cc1nnc(C(=O)OC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C6H3F5N2O2S/c1-2-12-13-3(16-2)4(14)15-6(10,11)5(7,8)9/h1H3 |
| InChIKey | BKIBRGKMHJRUCR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|