C17H21F3N6O2S2 — CID 59126866
N-[2-ethyl-1-propyl-6-(1,3,4-thiadiazol-2-yldiazenyl)-3,4-dihydro-2H-quinolin-7-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 59126866) has the molecular formula C17H21F3N6O2S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[2-ethyl-1-propyl-6-(1,3,4-thiadiazol-2-yldiazenyl)-3,4-dihydro-2H-quinolin-7-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-ethyl-1-propyl-6-(1,3,4-thiadiazol-2-yldiazenyl)-3,4-dihydro-2H-quinolin-7-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 59126866 |
| Molecular Formula | C17H21F3N6O2S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[2-ethyl-1-propyl-6-(1,3,4-thiadiazol-2-yldiazenyl)-3,4-dihydro-2H-quinolin-7-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCCN1c2cc(NS(=O)(=O)C(F)(F)F)c(/N=N/c3nncs3)cc2CCC1CC |
| InChI | InChI=1S/C17H21F3N6O2S2/c1-3-7-26-12(4-2)6-5-11-8-13(22-24-16-23-21-10-29-16)14(9-15(11)26)25-30(27,28)17(18,19)20/h8-10,12,25H,3-7H2,1-2H3/b24-22+ |
| InChIKey | WMHAGFOJPPEHLS-ZNTNEXAZSA-N |
| XLogP | 5.16 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|