About (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane
(2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane (PubChem CID 59127101) has the molecular formula C8H16F2O
and a molecular weight of 166.21 g/mol. Its IUPAC name is (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane.
Molecular Properties
| Compound Name | (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane |
| PubChem CID | 59127101 |
| Molecular Formula | C8H16F2O |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane |
| SMILES | C[C@@H](COC(F)F)C(C)(C)C |
| InChI | InChI=1S/C8H16F2O/c1-6(8(2,3)4)5-11-7(9)10/h6-7H,5H2,1-4H3/t6-/m0/s1 |
| InChIKey | NOQMQRBJAZBBBS-LURJTMIESA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane?
The IUPAC name of (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane (CID 59127101) is (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane.
What is the SMILES notation for (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane?
The canonical SMILES for (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane is C[C@@H](COC(F)F)C(C)(C)C.
What is the InChIKey of (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane?
The InChIKey is NOQMQRBJAZBBBS-LURJTMIESA-N. The full InChI is InChI=1S/C8H16F2O/c1-6(8(2,3)4)5-11-7(9)10/h6-7H,5H2,1-4H3/t6-/m0/s1.
What are the key properties of (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane?
(2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane has a molecular weight of 166.21 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(difluoromethoxy)-2,3,3-trimethylbutane is sourced from PubChem (CID 59127101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).