About 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one
5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one (PubChem CID 59127460) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one |
| PubChem CID | 59127460 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one |
| SMILES | CC(C)Cc1ccc2c(c1O)C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C14H18O4/c1-8(2)7-9-5-6-10-11(12(9)15)13(16)18-14(3,4)17-10/h5-6,8,15H,7H2,1-4H3 |
| InChIKey | UUJDTQDXXLKGQW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one?
The IUPAC name of 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one (CID 59127460) is 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one.
What is the SMILES notation for 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one?
The canonical SMILES for 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one is CC(C)Cc1ccc2c(c1O)C(=O)OC(C)(C)O2.
What is the InChIKey of 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one?
The InChIKey is UUJDTQDXXLKGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-8(2)7-9-5-6-10-11(12(9)15)13(16)18-14(3,4)17-10/h5-6,8,15H,7H2,1-4H3.
What are the key properties of 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one?
5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one has a molecular weight of 250.29 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,2-dimethyl-6-(2-methylpropyl)-1,3-benzodioxin-4-one is sourced from PubChem (CID 59127460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).