About 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride
2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride (PubChem CID 59127867) has the molecular formula C28H37Cl2NO2
and a molecular weight of 490.52 g/mol. Its IUPAC name is 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride.
Molecular Properties
| Compound Name | 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride |
| PubChem CID | 59127867 |
| Molecular Formula | C28H37Cl2NO2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride |
| SMILES | CCC(CC(C)c1cc(C(C)(C)C)nc(C(C)(C)C)c1)c1ccc(C(C(=O)Cl)C(=O)Cl)cc1 |
| InChI | InChI=1S/C28H37Cl2NO2/c1-9-18(19-10-12-20(13-11-19)24(25(29)32)26(30)33)14-17(2)21-15-22(27(3,4)5)31-23(16-21)28(6,7)8/h10-13,15-18,24H,9,14H2,1-8H3 |
| InChIKey | VWMXTMMUQMZGBL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride?
The IUPAC name of 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride (CID 59127867) is 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride.
What is the SMILES notation for 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride?
The canonical SMILES for 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride is CCC(CC(C)c1cc(C(C)(C)C)nc(C(C)(C)C)c1)c1ccc(C(C(=O)Cl)C(=O)Cl)cc1.
What is the InChIKey of 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride?
The InChIKey is VWMXTMMUQMZGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37Cl2NO2/c1-9-18(19-10-12-20(13-11-19)24(25(29)32)26(30)33)14-17(2)21-15-22(27(3,4)5)31-23(16-21)28(6,7)8/h10-13,15-18,24H,9,14H2,1-8H3.
What are the key properties of 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride?
2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride has a molecular weight of 490.52 g/mol, XLogP of 7.98, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[5-(2,6-ditert-butyl-4-pyridinyl)hexan-3-yl]phenyl]propanedioyl dichloride is sourced from PubChem (CID 59127867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).