About CID 59128086
CID 59128086 (PubChem CID 59128086) has the molecular formula C9H17O4Si
and a molecular weight of 217.32 g/mol.
Molecular Properties
| Compound Name | CID 59128086 |
| PubChem CID | 59128086 |
| Molecular Formula | C9H17O4Si |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCC(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C9H17O4Si/c1-14(2)4-3-7(5-8(10)11)6-9(12)13/h7H,3-6H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | GUHYIIJNBYMABX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59128086 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59128086?
The IUPAC name of CID 59128086 (CID 59128086) is not available.
What is the SMILES notation for CID 59128086?
The canonical SMILES for CID 59128086 is C[Si](C)CCC(CC(=O)O)CC(=O)O.
What is the InChIKey of CID 59128086?
The InChIKey is GUHYIIJNBYMABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O4Si/c1-14(2)4-3-7(5-8(10)11)6-9(12)13/h7H,3-6H2,1-2H3,(H,10,11)(H,12,13).
What are the key properties of CID 59128086?
CID 59128086 has a molecular weight of 217.32 g/mol, XLogP of 1.70, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59128086 is sourced from PubChem (CID 59128086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).