About 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one
4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one (PubChem CID 59128138) has the molecular formula C5H2F6O3
and a molecular weight of 224.06 g/mol. Its IUPAC name is 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one |
| PubChem CID | 59128138 |
| Molecular Formula | C5H2F6O3 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OC(C(F)(F)F)C(C(F)(F)F)O1 |
| InChI | InChI=1S/C5H2F6O3/c6-4(7,8)1-2(5(9,10)11)14-3(12)13-1/h1-2H |
| InChIKey | SGGPSSHEWWGIPZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
The IUPAC name of 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one (CID 59128138) is 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
The canonical SMILES for 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one is O=C1OC(C(F)(F)F)C(C(F)(F)F)O1.
What is the InChIKey of 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
The InChIKey is SGGPSSHEWWGIPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F6O3/c6-4(7,8)1-2(5(9,10)11)14-3(12)13-1/h1-2H.
What are the key properties of 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one has a molecular weight of 224.06 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one is sourced from PubChem (CID 59128138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).