C27H36N6O4 — CID 59128430
tert-butyl 4-[[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]piperidine-1-carboxylate (PubChem CID 59128430) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl 4-[[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59128430 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | tert-butyl 4-[[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]piperidine-1-carboxylate |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc2[nH]c(COC3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C27H36N6O4/c1-18(34)28-12-13-29-24-22-16-20(30-25(22)32-23(31-24)19-8-6-5-7-9-19)17-36-21-10-14-33(15-11-21)26(35)37-27(2,3)4/h5-9,16,21H,10-15,17H2,1-4H3,(H,28,34)(H2,29,30,31,32) |
| InChIKey | ATTDKIMKSWNMRG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|