About 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one
3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 59128621) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one.
Molecular Properties
| Compound Name | 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one |
| PubChem CID | 59128621 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC(C)N1CCC2(CC1)NCN(C)C2=O |
| InChI | InChI=1S/C11H21N3O/c1-9(2)14-6-4-11(5-7-14)10(15)13(3)8-12-11/h9,12H,4-8H2,1-3H3 |
| InChIKey | LYDPOJKZFPXHMH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one?
The IUPAC name of 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one (CID 59128621) is 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one.
What is the SMILES notation for 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one?
The canonical SMILES for 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one is CC(C)N1CCC2(CC1)NCN(C)C2=O.
What is the InChIKey of 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one?
The InChIKey is LYDPOJKZFPXHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-9(2)14-6-4-11(5-7-14)10(15)13(3)8-12-11/h9,12H,4-8H2,1-3H3.
What are the key properties of 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one?
3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one has a molecular weight of 211.31 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]decan-4-one is sourced from PubChem (CID 59128621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).