C25H33N5OSSi — CID 59128668
N,N-dimethyl-3-[3-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline (PubChem CID 59128668) has the molecular formula C25H33N5OSSi and a molecular weight of 479.73 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline.
| Compound Name | N,N-dimethyl-3-[3-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline |
|---|---|
| PubChem CID | 59128668 |
| Molecular Formula | C25H33N5OSSi |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N,N-dimethyl-3-[3-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline |
| SMILES | CN(C)c1cccc(Sc2cnc3c(c2)c(-c2cnn(C)c2)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C25H33N5OSSi/c1-28(2)20-8-7-9-21(12-20)32-22-13-23-24(19-14-27-29(3)16-19)17-30(25(23)26-15-22)18-31-10-11-33(4,5)6/h7-9,12-17H,10-11,18H2,1-6H3 |
| InChIKey | WKQLVKPYNVJNND-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|