C26H38N4O3Si — CID 59128703
2-[[5-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 59128703) has the molecular formula C26H38N4O3Si and a molecular weight of 482.70 g/mol. Its IUPAC name is 2-[[5-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 59128703 |
| Molecular Formula | C26H38N4O3Si |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-[[5-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cn1cc(-c2cn(COCC[Si](C)(C)C)c3ncc(CC4CCC5(CC4)OCCO5)cc23)cn1 |
| InChI | InChI=1S/C26H38N4O3Si/c1-29-17-22(16-28-29)24-18-30(19-31-11-12-34(2,3)4)25-23(24)14-21(15-27-25)13-20-5-7-26(8-6-20)32-9-10-33-26/h14-18,20H,5-13,19H2,1-4H3 |
| InChIKey | ZCARQBOZUVOFQW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|