C19H17F5N2OS2 — CID 59128780
N-[2-(2-tert-butylphenoxy)thiophen-3-yl]-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine (PubChem CID 59128780) has the molecular formula C19H17F5N2OS2 and a molecular weight of 448.48 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)thiophen-3-yl]-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | N-[2-(2-tert-butylphenoxy)thiophen-3-yl]-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 59128780 |
| Molecular Formula | C19H17F5N2OS2 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)thiophen-3-yl]-4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)c1ccccc1Oc1sccc1Nc1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C19H17F5N2OS2/c1-17(2,3)11-6-4-5-7-13(11)27-15-12(8-9-28-15)25-16-26-14(10-29-16)18(20,21)19(22,23)24/h4-10H,1-3H3,(H,25,26) |
| InChIKey | GLUIYPAHTFFULS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|