C17H19NOS — CID 59128829
2-tert-butyl-5-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 59128829) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-tert-butyl-5-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-tert-butyl-5-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 59128829 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-tert-butyl-5-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | CC(C)(C)c1nc2c(s1)C(=O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C17H19NOS/c1-17(2,3)16-18-13-9-12(10-14(19)15(13)20-16)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3 |
| InChIKey | KNHYEILFCOTUDU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |