About CID 59129145
CID 59129145 (PubChem CID 59129145) has the molecular formula C4H6F2N
and a molecular weight of 106.09 g/mol.
Molecular Properties
| Compound Name | CID 59129145 |
| PubChem CID | 59129145 |
| Molecular Formula | C4H6F2N |
| Molecular Weight | 106.09 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | — |
| SMILES | [NH]CC1CC1(F)F |
| InChI | InChI=1S/C4H6F2N/c5-4(6)1-3(4)2-7/h3,7H,1-2H2 |
| InChIKey | MKJGLTUVLXPWDH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.09 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 59129145 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59129145?
The IUPAC name of CID 59129145 (CID 59129145) is not available.
What is the SMILES notation for CID 59129145?
The canonical SMILES for CID 59129145 is [NH]CC1CC1(F)F.
What is the InChIKey of CID 59129145?
The InChIKey is MKJGLTUVLXPWDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2N/c5-4(6)1-3(4)2-7/h3,7H,1-2H2.
What are the key properties of CID 59129145?
CID 59129145 has a molecular weight of 106.09 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59129145 is sourced from PubChem (CID 59129145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).