About 3,3-di(propan-2-yl)thiane
3,3-di(propan-2-yl)thiane (PubChem CID 59129253) has the molecular formula C11H22S
and a molecular weight of 186.36 g/mol. Its IUPAC name is 3,3-di(propan-2-yl)thiane.
Molecular Properties
| Compound Name | 3,3-di(propan-2-yl)thiane |
| PubChem CID | 59129253 |
| Molecular Formula | C11H22S |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3,3-di(propan-2-yl)thiane |
| SMILES | CC(C)C1(C(C)C)CCCSC1 |
| InChI | InChI=1S/C11H22S/c1-9(2)11(10(3)4)6-5-7-12-8-11/h9-10H,5-8H2,1-4H3 |
| InChIKey | IMSVCWYOFGDGFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-di(propan-2-yl)thiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-di(propan-2-yl)thiane?
The IUPAC name of 3,3-di(propan-2-yl)thiane (CID 59129253) is 3,3-di(propan-2-yl)thiane.
What is the SMILES notation for 3,3-di(propan-2-yl)thiane?
The canonical SMILES for 3,3-di(propan-2-yl)thiane is CC(C)C1(C(C)C)CCCSC1.
What is the InChIKey of 3,3-di(propan-2-yl)thiane?
The InChIKey is IMSVCWYOFGDGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22S/c1-9(2)11(10(3)4)6-5-7-12-8-11/h9-10H,5-8H2,1-4H3.
What are the key properties of 3,3-di(propan-2-yl)thiane?
3,3-di(propan-2-yl)thiane has a molecular weight of 186.36 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-di(propan-2-yl)thiane is sourced from PubChem (CID 59129253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).