C26H24F2N2O6 — CID 59129263
3-[2-tert-butyl-5-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]indol-1-yl]-2-oxopropanoic acid (PubChem CID 59129263) has the molecular formula C26H24F2N2O6 and a molecular weight of 498.48 g/mol. Its IUPAC name is 3-[2-tert-butyl-5-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]indol-1-yl]-2-oxopropanoic acid.
| Compound Name | 3-[2-tert-butyl-5-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]indol-1-yl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 59129263 |
| Molecular Formula | C26H24F2N2O6 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-[2-tert-butyl-5-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]indol-1-yl]-2-oxopropanoic acid |
| SMILES | CC(C)(C)c1cc2cc(NC(=O)C3(c4ccc5c(c4)OC(F)(F)O5)CC3)ccc2n1CC(=O)C(=O)O |
| InChI | InChI=1S/C26H24F2N2O6/c1-24(2,3)21-11-14-10-16(5-6-17(14)30(21)13-18(31)22(32)33)29-23(34)25(8-9-25)15-4-7-19-20(12-15)36-26(27,28)35-19/h4-7,10-12H,8-9,13H2,1-3H3,(H,29,34)(H,32,33) |
| InChIKey | RHCLNWDHWCNLNZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|