1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid

C11H9NO3 — CID 59129317

IUPAC1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid
SMILESO=C(O)C1(c2ccc3ocnc3c2)CC1
InChIInChI=1S/C11H9NO3/c13-10(14)11(3-4-11)7-1-2-9-8(5-7)12-6-15-9/h1-2,5-6H,3-4H2,(H,13,14)
InChIKeyMRBYETGWOTWPIY-UHFFFAOYSA-N
MW203.20 g/mol
LogP1.94
Rot. Bonds2

About 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid

1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid (PubChem CID 59129317) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid
PubChem CID59129317
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid
SMILESO=C(O)C1(c2ccc3ocnc3c2)CC1
InChIInChI=1S/C11H9NO3/c13-10(14)11(3-4-11)7-1-2-9-8(5-7)12-6-15-9/h1-2,5-6H,3-4H2,(H,13,14)
InChIKeyMRBYETGWOTWPIY-UHFFFAOYSA-N
XLogP1.94
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid (CID 59129317) is 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid is O=C(O)C1(c2ccc3ocnc3c2)CC1.
What is the InChIKey of 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid?
The InChIKey is MRBYETGWOTWPIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c13-10(14)11(3-4-11)7-1-2-9-8(5-7)12-6-15-9/h1-2,5-6H,3-4H2,(H,13,14).
What are the key properties of 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid?
1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzoxazol-5-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 59129317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).