C42H57N9O6S3 — CID 59129591
1-N,3-N,5-N-tris[(2S)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylmethylamino)butan-2-yl]cyclohexane-1,3,5-tricarboxamide (PubChem CID 59129591) has the molecular formula C42H57N9O6S3 and a molecular weight of 880.18 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris[(2S)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylmethylamino)butan-2-yl]cyclohexane-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris[(2S)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylmethylamino)butan-2-yl]cyclohexane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 59129591 |
| Molecular Formula | C42H57N9O6S3 |
| Molecular Weight | 880.18 g/mol |
| Exact Mass | 879.36 |
| IUPAC Name | 1-N,3-N,5-N-tris[(2S)-4-methylsulfanyl-1-oxo-1-(pyridin-4-ylmethylamino)butan-2-yl]cyclohexane-1,3,5-tricarboxamide |
| SMILES | CSCC[C@H](NC(=O)C1CC(C(=O)N[C@@H](CCSC)C(=O)NCc2ccncc2)CC(C(=O)N[C@@H](CCSC)C(=O)NCc2ccncc2)C1)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C42H57N9O6S3/c1-58-19-10-34(40(55)46-25-28-4-13-43-14-5-28)49-37(52)31-22-32(38(53)50-35(11-20-59-2)41(56)47-26-29-6-15-44-16-7-29)24-33(23-31)39(54)51-36(12-21-60-3)42(57)48-27-30-8-17-45-18-9-30/h4-9,13-18,31-36H,10-12,19-27H2,1-3H3,(H,46,55)(H,47,56)(H,48,57)(H,49,52)(H,50,53)(H,51,54)/t31?,32?,33?,34-,35-,36-/m0/s1 |
| InChIKey | ZTDLZNCZOXJLQN-ISIKTUABSA-N |
| XLogP | 2.87 |
| TPSA | 213.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |