C22H24O6 — CID 59129921
[(3S,3aR,6R,6aR)-3-[(4-methylphenoxy)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzoate (PubChem CID 59129921) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-[(4-methylphenoxy)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzoate.
| Compound Name | [(3S,3aR,6R,6aR)-3-[(4-methylphenoxy)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 59129921 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-[(4-methylphenoxy)methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(OCO[C@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H24O6/c1-14-3-7-16(8-4-14)22(23)28-19-12-25-20-18(11-24-21(19)20)27-13-26-17-9-5-15(2)6-10-17/h3-10,18-21H,11-13H2,1-2H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | YIARGNBVSCRLOE-DOIPELPJSA-N |
| XLogP | 3.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|