About spiro[1,3-dithiane-2,2'-3H-1-benzofuran]
spiro[1,3-dithiane-2,2'-3H-1-benzofuran] (PubChem CID 59130031) has the molecular formula C11H12OS2
and a molecular weight of 224.35 g/mol. Its IUPAC name is spiro[1,3-dithiane-2,2'-3H-1-benzofuran].
Molecular Properties
| Compound Name | spiro[1,3-dithiane-2,2'-3H-1-benzofuran] |
| PubChem CID | 59130031 |
| Molecular Formula | C11H12OS2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | spiro[1,3-dithiane-2,2'-3H-1-benzofuran] |
| SMILES | c1ccc2c(c1)CC1(O2)SCCCS1 |
| InChI | InChI=1S/C11H12OS2/c1-2-5-10-9(4-1)8-11(12-10)13-6-3-7-14-11/h1-2,4-5H,3,6-8H2 |
| InChIKey | UVDKRFKOPWWIKA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-dithiane-2,2'-3H-1-benzofuran] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dithiane-2,2'-3H-1-benzofuran]?
The IUPAC name of spiro[1,3-dithiane-2,2'-3H-1-benzofuran] (CID 59130031) is spiro[1,3-dithiane-2,2'-3H-1-benzofuran].
What is the SMILES notation for spiro[1,3-dithiane-2,2'-3H-1-benzofuran]?
The canonical SMILES for spiro[1,3-dithiane-2,2'-3H-1-benzofuran] is c1ccc2c(c1)CC1(O2)SCCCS1.
What is the InChIKey of spiro[1,3-dithiane-2,2'-3H-1-benzofuran]?
The InChIKey is UVDKRFKOPWWIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12OS2/c1-2-5-10-9(4-1)8-11(12-10)13-6-3-7-14-11/h1-2,4-5H,3,6-8H2.
What are the key properties of spiro[1,3-dithiane-2,2'-3H-1-benzofuran]?
spiro[1,3-dithiane-2,2'-3H-1-benzofuran] has a molecular weight of 224.35 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dithiane-2,2'-3H-1-benzofuran] is sourced from PubChem (CID 59130031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).