C18H36O4Si2 — CID 59130197
cis-(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,4-dione (PubChem CID 59130197) has the molecular formula C18H36O4Si2 and a molecular weight of 372.65 g/mol. Its IUPAC name is cis-(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,4-dione.
| Compound Name | cis-(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,4-dione |
|---|---|
| PubChem CID | 59130197 |
| Molecular Formula | C18H36O4Si2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | cis-(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexane-1,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H36O4Si2/c1-17(2,3)23(7,8)21-14-11-13(19)12-15(16(14)20)22-24(9,10)18(4,5)6/h14-15H,11-12H2,1-10H3/t14-,15+ |
| InChIKey | NZIDCOJZBNPANF-GASCZTMLSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|