C23H20N6S — CID 59130299
4-N-(1H-indazol-5-yl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 59130299) has the molecular formula C23H20N6S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-N-(1H-indazol-5-yl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-5-yl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59130299 |
| Molecular Formula | C23H20N6S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-N-(1H-indazol-5-yl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | c1ccc2c(c1)CCCC2Nc1nc(Nc2ccc3[nH]ncc3c2)c2sccc2n1 |
| InChI | InChI=1S/C23H20N6S/c1-2-6-17-14(4-1)5-3-7-19(17)26-23-27-20-10-11-30-21(20)22(28-23)25-16-8-9-18-15(12-16)13-24-29-18/h1-2,4,6,8-13,19H,3,5,7H2,(H,24,29)(H2,25,26,27,28) |
| InChIKey | UZMHVOPBVHRESE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |